C26H37NO3S — CID 142259313
acetylene;5-methyl-2-octoxy-4-(5-phenylpentylsulfanyl)-1,3-oxazin-6-one (PubChem CID 142259313) has the molecular formula C26H37NO3S and a molecular weight of 443.65 g/mol. Its IUPAC name is acetylene;5-methyl-2-octoxy-4-(5-phenylpentylsulfanyl)-1,3-oxazin-6-one.
| Compound Name | acetylene;5-methyl-2-octoxy-4-(5-phenylpentylsulfanyl)-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 142259313 |
| Molecular Formula | C26H37NO3S |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | acetylene;5-methyl-2-octoxy-4-(5-phenylpentylsulfanyl)-1,3-oxazin-6-one |
| SMILES | C#C.CCCCCCCCOc1nc(SCCCCCc2ccccc2)c(C)c(=O)o1 |
| InChI | InChI=1S/C24H35NO3S.C2H2/c1-3-4-5-6-7-13-18-27-24-25-22(20(2)23(26)28-24)29-19-14-9-12-17-21-15-10-8-11-16-21;1-2/h8,10-11,15-16H,3-7,9,12-14,17-19H2,1-2H3;1-2H |
| InChIKey | SIHMKRLTFBHOGP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|