About 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol
1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol (PubChem CID 142260331) has the molecular formula C25H27ClF2O2
and a molecular weight of 432.94 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol.
Molecular Properties
| Compound Name | 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol |
| PubChem CID | 142260331 |
| Molecular Formula | C25H27ClF2O2 |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol |
| SMILES | CCCO.Cc1ccc(Cl)cc1.OC1(c2cc(F)ccc2F)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H12F2O.C7H7Cl.C3H8O/c16-12-5-6-14(17)13(7-12)15(18)8-10-3-1-2-4-11(10)9-15;1-6-2-4-7(8)5-3-6;1-2-3-4/h1-7,18H,8-9H2;2-5H,1H3;4H,2-3H2,1H3 |
| InChIKey | RNYJCCOQFUNOTH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol?
The IUPAC name of 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol (CID 142260331) is 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol.
What is the SMILES notation for 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol?
The canonical SMILES for 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol is CCCO.Cc1ccc(Cl)cc1.OC1(c2cc(F)ccc2F)Cc2ccccc2C1.
What is the InChIKey of 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol?
The InChIKey is RNYJCCOQFUNOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2O.C7H7Cl.C3H8O/c16-12-5-6-14(17)13(7-12)15(18)8-10-3-1-2-4-11(10)9-15;1-6-2-4-7(8)5-3-6;1-2-3-4/h1-7,18H,8-9H2;2-5H,1H3;4H,2-3H2,1H3.
What are the key properties of 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol?
1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol has a molecular weight of 432.94 g/mol, XLogP of 5.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene;2-(2,5-difluorophenyl)-1,3-dihydroinden-2-ol;propan-1-ol is sourced from PubChem (CID 142260331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).