C23H15N5O2 — CID 1422604
6-(3-nitrophenyl)-2,3-diphenylimidazo[1,2-b][1,2,4]triazine (PubChem CID 1422604) has the molecular formula C23H15N5O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-2,3-diphenylimidazo[1,2-b][1,2,4]triazine.
| Compound Name | 6-(3-nitrophenyl)-2,3-diphenylimidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 1422604 |
| Molecular Formula | C23H15N5O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 6-(3-nitrophenyl)-2,3-diphenylimidazo[1,2-b][1,2,4]triazine |
| SMILES | O=[N+]([O-])c1cccc(-c2cn3nc(-c4ccccc4)c(-c4ccccc4)nc3n2)c1 |
| InChI | InChI=1S/C23H15N5O2/c29-28(30)19-13-7-12-18(14-19)20-15-27-23(24-20)25-21(16-8-3-1-4-9-16)22(26-27)17-10-5-2-6-11-17/h1-15H |
| InChIKey | LARFSQLRRJKLFU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|