C29H46N4 — CID 142260723
acetylene;(3Z)-3-[(Z)-but-2-enylidene]-N-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]methyl]cyclohexan-1-amine;oct-7-en-2-amine (PubChem CID 142260723) has the molecular formula C29H46N4 and a molecular weight of 450.72 g/mol. Its IUPAC name is acetylene;(3Z)-3-[(Z)-but-2-enylidene]-N-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]methyl]cyclohexan-1-amine;oct-7-en-2-amine.
| Compound Name | acetylene;(3Z)-3-[(Z)-but-2-enylidene]-N-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]methyl]cyclohexan-1-amine;oct-7-en-2-amine |
|---|---|
| PubChem CID | 142260723 |
| Molecular Formula | C29H46N4 |
| Molecular Weight | 450.72 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | acetylene;(3Z)-3-[(Z)-but-2-enylidene]-N-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]methyl]cyclohexan-1-amine;oct-7-en-2-amine |
| SMILES | C#C.C=CCCCCC(C)N.C=Cc1nc(CNC2CCC/C(=C/C=C\C)C2)[nH]c1/C=C\C |
| InChI | InChI=1S/C19H27N3.C8H17N.C2H2/c1-4-7-10-15-11-8-12-16(13-15)20-14-19-21-17(6-3)18(22-19)9-5-2;1-3-4-5-6-7-8(2)9;1-2/h4-7,9-10,16,20H,3,8,11-14H2,1-2H3,(H,21,22);3,8H,1,4-7,9H2,2H3;1-2H/b7-4-,9-5-,15-10-;; |
| InChIKey | SJRUEZUMEGBUCK-DSYRJCGVSA-N |
| XLogP | 6.95 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|