C25H30N4O3S — CID 142261320
N-[3-(3-acetamidopropyl)-4-(4-tert-butylphenyl)-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide (PubChem CID 142261320) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-[3-(3-acetamidopropyl)-4-(4-tert-butylphenyl)-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-(3-acetamidopropyl)-4-(4-tert-butylphenyl)-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142261320 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[3-(3-acetamidopropyl)-4-(4-tert-butylphenyl)-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide |
| SMILES | CC(=O)NCCCn1c(-c2ccc(C(C)(C)C)cc2)cs/c1=N\C(=O)c1ccc(CO)nc1 |
| InChI | InChI=1S/C25H30N4O3S/c1-17(31)26-12-5-13-29-22(18-6-9-20(10-7-18)25(2,3)4)16-33-24(29)28-23(32)19-8-11-21(15-30)27-14-19/h6-11,14,16,30H,5,12-13,15H2,1-4H3,(H,26,31)/b28-24- |
| InChIKey | ZHSYDEYLDUNDMM-COOPMVRXSA-N |
| XLogP | 3.67 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|