C15H12N2O3 — CID 142261906
8-methyl-11-nitro-7-azatricyclo[10.2.1.05,14]pentadeca-1(14),2,4,8,10,12-hexaen-6-one (PubChem CID 142261906) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 8-methyl-11-nitro-7-azatricyclo[10.2.1.05,14]pentadeca-1(14),2,4,8,10,12-hexaen-6-one.
| Compound Name | 8-methyl-11-nitro-7-azatricyclo[10.2.1.05,14]pentadeca-1(14),2,4,8,10,12-hexaen-6-one |
|---|---|
| PubChem CID | 142261906 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 8-methyl-11-nitro-7-azatricyclo[10.2.1.05,14]pentadeca-1(14),2,4,8,10,12-hexaen-6-one |
| SMILES | Cc1ccc([N+](=O)[O-])c2cc3c(cccc3c(=O)[nH]1)C2 |
| InChI | InChI=1S/C15H12N2O3/c1-9-5-6-14(17(19)20)11-7-10-3-2-4-12(13(10)8-11)15(18)16-9/h2-6,8H,7H2,1H3,(H,16,18) |
| InChIKey | GYHOACDNLKNVOA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|