C11H13N3O — CID 142262030
N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-pyrazole-5-carboxamide (PubChem CID 142262030) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 142262030 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-pyrazole-5-carboxamide |
| SMILES | C=C/C(=C\C=C/C)NC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C11H13N3O/c1-3-5-6-9(4-2)13-11(15)10-7-8-12-14-10/h3-8H,2H2,1H3,(H,12,14)(H,13,15)/b5-3-,9-6+ |
| InChIKey | LZRIFXCTSBJSKS-PAEKIZANSA-N |
| XLogP | 1.79 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|