C13H23FN4 — CID 142263684
(Z)-1-N-[(1E,3E,5E)-1-(ethylamino)-6-fluorohepta-1,3,5-trien-4-yl]-3-N-methylprop-1-ene-1,2,3-triamine (PubChem CID 142263684) has the molecular formula C13H23FN4 and a molecular weight of 254.35 g/mol. Its IUPAC name is (Z)-1-N-[(1E,3E,5E)-1-(ethylamino)-6-fluorohepta-1,3,5-trien-4-yl]-3-N-methylprop-1-ene-1,2,3-triamine.
| Compound Name | (Z)-1-N-[(1E,3E,5E)-1-(ethylamino)-6-fluorohepta-1,3,5-trien-4-yl]-3-N-methylprop-1-ene-1,2,3-triamine |
|---|---|
| PubChem CID | 142263684 |
| Molecular Formula | C13H23FN4 |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (Z)-1-N-[(1E,3E,5E)-1-(ethylamino)-6-fluorohepta-1,3,5-trien-4-yl]-3-N-methylprop-1-ene-1,2,3-triamine |
| SMILES | CCN/C=C/C=C(\C=C(/C)F)N/C=C(\N)CNC |
| InChI | InChI=1S/C13H23FN4/c1-4-17-7-5-6-13(8-11(2)14)18-10-12(15)9-16-3/h5-8,10,16-18H,4,9,15H2,1-3H3/b7-5+,11-8+,12-10-,13-6+ |
| InChIKey | KMEWLARNRWWMSH-FOBGGYJVSA-N |
| XLogP | 1.48 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|