C12H20F2N2S — CID 142263777
(3E,5Z)-5-N-ethyl-4,6-difluoro-5-N-(2-methylsulfanylethyl)hepta-1,3,5-triene-2,5-diamine (PubChem CID 142263777) has the molecular formula C12H20F2N2S and a molecular weight of 262.37 g/mol. Its IUPAC name is (3E,5Z)-5-N-ethyl-4,6-difluoro-5-N-(2-methylsulfanylethyl)hepta-1,3,5-triene-2,5-diamine.
| Compound Name | (3E,5Z)-5-N-ethyl-4,6-difluoro-5-N-(2-methylsulfanylethyl)hepta-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 142263777 |
| Molecular Formula | C12H20F2N2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (3E,5Z)-5-N-ethyl-4,6-difluoro-5-N-(2-methylsulfanylethyl)hepta-1,3,5-triene-2,5-diamine |
| SMILES | C=C(N)/C=C(F)\C(=C(/C)F)N(CC)CCSC |
| InChI | InChI=1S/C12H20F2N2S/c1-5-16(6-7-17-4)12(10(3)13)11(14)8-9(2)15/h8H,2,5-7,15H2,1,3-4H3/b11-8+,12-10- |
| InChIKey | QMOVJBMMGIAHCL-GWPDKMJPSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|