C6H6N2S2 — CID 142264073
3-methyl-2H-thieno[3,2-e][1,2,4]thiadiazine (PubChem CID 142264073) has the molecular formula C6H6N2S2 and a molecular weight of 170.26 g/mol. Its IUPAC name is 3-methyl-2H-thieno[3,2-e][1,2,4]thiadiazine.
| Compound Name | 3-methyl-2H-thieno[3,2-e][1,2,4]thiadiazine |
|---|---|
| PubChem CID | 142264073 |
| Molecular Formula | C6H6N2S2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 3-methyl-2H-thieno[3,2-e][1,2,4]thiadiazine |
| SMILES | CC1=Nc2ccsc2SN1 |
| InChI | InChI=1S/C6H6N2S2/c1-4-7-5-2-3-9-6(5)10-8-4/h2-3H,1H3,(H,7,8) |
| InChIKey | PTYZVBKIZFSFQE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|