C20H15BrN2O — CID 142264655
1-[(3-bromophenyl)methyl]-4-methyl-2-oxo-6-phenylpyridine-3-carbonitrile (PubChem CID 142264655) has the molecular formula C20H15BrN2O and a molecular weight of 379.26 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-4-methyl-2-oxo-6-phenylpyridine-3-carbonitrile.
| Compound Name | 1-[(3-bromophenyl)methyl]-4-methyl-2-oxo-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142264655 |
| Molecular Formula | C20H15BrN2O |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-4-methyl-2-oxo-6-phenylpyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccccc2)n(Cc2cccc(Br)c2)c(=O)c1C#N |
| InChI | InChI=1S/C20H15BrN2O/c1-14-10-19(16-7-3-2-4-8-16)23(20(24)18(14)12-22)13-15-6-5-9-17(21)11-15/h2-11H,13H2,1H3 |
| InChIKey | PXDBZDKEFJEFED-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |