About (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate
(2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate (PubChem CID 142264818) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate.
Molecular Properties
| Compound Name | (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate |
| PubChem CID | 142264818 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate |
| SMILES | CC/C=C\C(=N/C)OCC(C)(C)N |
| InChI | InChI=1S/C10H20N2O/c1-5-6-7-9(12-4)13-8-10(2,3)11/h6-7H,5,8,11H2,1-4H3/b7-6-,12-9+ |
| InChIKey | BAZPXRHEYWXRHH-IYNHQRNQSA-N |
| XLogP | 1.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate?
The IUPAC name of (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate (CID 142264818) is (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate.
What is the SMILES notation for (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate?
The canonical SMILES for (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate is CC/C=C\C(=N/C)OCC(C)(C)N.
What is the InChIKey of (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate?
The InChIKey is BAZPXRHEYWXRHH-IYNHQRNQSA-N. The full InChI is InChI=1S/C10H20N2O/c1-5-6-7-9(12-4)13-8-10(2,3)11/h6-7H,5,8,11H2,1-4H3/b7-6-,12-9+.
What are the key properties of (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate?
(2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate has a molecular weight of 184.28 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-methylpropyl) (Z)-N-methylpent-2-enimidate is sourced from PubChem (CID 142264818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).