C22H18FN3O2 — CID 142264908
2-fluoro-9-oxo-N-(1-pyridin-4-ylpropan-2-yl)-10H-acridine-3-carboxamide (PubChem CID 142264908) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 2-fluoro-9-oxo-N-(1-pyridin-4-ylpropan-2-yl)-10H-acridine-3-carboxamide.
| Compound Name | 2-fluoro-9-oxo-N-(1-pyridin-4-ylpropan-2-yl)-10H-acridine-3-carboxamide |
|---|---|
| PubChem CID | 142264908 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-fluoro-9-oxo-N-(1-pyridin-4-ylpropan-2-yl)-10H-acridine-3-carboxamide |
| SMILES | CC(Cc1ccncc1)NC(=O)c1cc2[nH]c3ccccc3c(=O)c2cc1F |
| InChI | InChI=1S/C22H18FN3O2/c1-13(10-14-6-8-24-9-7-14)25-22(28)16-12-20-17(11-18(16)23)21(27)15-4-2-3-5-19(15)26-20/h2-9,11-13H,10H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | KTVLYYQBKFGMPC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|