C18H17F3O3 — CID 142264980
4,4,4-trifluoro-3-[(4-methyl-3,7-dihydroheptalen-3-yl)oxy]-2-methylidenebutanoic acid (PubChem CID 142264980) has the molecular formula C18H17F3O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[(4-methyl-3,7-dihydroheptalen-3-yl)oxy]-2-methylidenebutanoic acid.
| Compound Name | 4,4,4-trifluoro-3-[(4-methyl-3,7-dihydroheptalen-3-yl)oxy]-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 142264980 |
| Molecular Formula | C18H17F3O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4,4,4-trifluoro-3-[(4-methyl-3,7-dihydroheptalen-3-yl)oxy]-2-methylidenebutanoic acid |
| SMILES | C=C(C(=O)O)C(OC1C=CC2=CC=CCC=C2C=C1C)C(F)(F)F |
| InChI | InChI=1S/C18H17F3O3/c1-11-10-14-7-5-3-4-6-13(14)8-9-15(11)24-16(18(19,20)21)12(2)17(22)23/h3-4,6-10,15-16H,2,5H2,1H3,(H,22,23) |
| InChIKey | ZHKVAWOBUCSDIH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|