C56H70O4P2 — CID 142265890
(2,4-ditert-butylphenoxy)-[2-[1-[(2,4-ditert-butylphenoxy)-phenylphosphanyl]oxy-3,5-dimethylcyclohexa-2,4-dien-1-yl]-4,6-dimethylphenoxy]-phenylphosphane (PubChem CID 142265890) has the molecular formula C56H70O4P2 and a molecular weight of 869.12 g/mol. Its IUPAC name is (2,4-ditert-butylphenoxy)-[2-[1-[(2,4-ditert-butylphenoxy)-phenylphosphanyl]oxy-3,5-dimethylcyclohexa-2,4-dien-1-yl]-4,6-dimethylphenoxy]-phenylphosphane.
| Compound Name | (2,4-ditert-butylphenoxy)-[2-[1-[(2,4-ditert-butylphenoxy)-phenylphosphanyl]oxy-3,5-dimethylcyclohexa-2,4-dien-1-yl]-4,6-dimethylphenoxy]-phenylphosphane |
|---|---|
| PubChem CID | 142265890 |
| Molecular Formula | C56H70O4P2 |
| Molecular Weight | 869.12 g/mol |
| Exact Mass | 868.47 |
| IUPAC Name | (2,4-ditert-butylphenoxy)-[2-[1-[(2,4-ditert-butylphenoxy)-phenylphosphanyl]oxy-3,5-dimethylcyclohexa-2,4-dien-1-yl]-4,6-dimethylphenoxy]-phenylphosphane |
| SMILES | CC1=CC(OP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c2ccccc2)(c2cc(C)cc(C)c2OP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c2ccccc2)CC(C)=C1 |
| InChI | InChI=1S/C56H70O4P2/c1-38-32-41(4)51(59-61(44-23-19-17-20-24-44)57-49-29-27-42(52(5,6)7)34-46(49)54(11,12)13)48(33-38)56(36-39(2)31-40(3)37-56)60-62(45-25-21-18-22-26-45)58-50-30-28-43(53(8,9)10)35-47(50)55(14,15)16/h17-36H,37H2,1-16H3 |
| InChIKey | LRIJIDUAZBTRDN-UHFFFAOYSA-N |
| XLogP | 15.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.12 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|