C21H40O6 — CID 142266133
2-[(4,4-dimethylcyclohexyl)methyl]-1,4,7,10,13,16-hexaoxacyclooctadecane (PubChem CID 142266133) has the molecular formula C21H40O6 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[(4,4-dimethylcyclohexyl)methyl]-1,4,7,10,13,16-hexaoxacyclooctadecane.
| Compound Name | 2-[(4,4-dimethylcyclohexyl)methyl]-1,4,7,10,13,16-hexaoxacyclooctadecane |
|---|---|
| PubChem CID | 142266133 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 2-[(4,4-dimethylcyclohexyl)methyl]-1,4,7,10,13,16-hexaoxacyclooctadecane |
| SMILES | CC1(C)CCC(CC2COCCOCCOCCOCCOCCO2)CC1 |
| InChI | InChI=1S/C21H40O6/c1-21(2)5-3-19(4-6-21)17-20-18-26-14-13-24-10-9-22-7-8-23-11-12-25-15-16-27-20/h19-20H,3-18H2,1-2H3 |
| InChIKey | MAUWPPPSARNETC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |