About 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one
2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 142266200) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 142266200 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(CO)nc2[nH]1 |
| InChI | InChI=1S/C8H7N3O2/c12-4-6-9-3-5-1-2-7(13)11-8(5)10-6/h1-3,12H,4H2,(H,9,10,11,13) |
| InChIKey | KHFNCHWLMLPTCK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one (CID 142266200) is 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one is O=c1ccc2cnc(CO)nc2[nH]1.
What is the InChIKey of 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is KHFNCHWLMLPTCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c12-4-6-9-3-5-1-2-7(13)11-8(5)10-6/h1-3,12H,4H2,(H,9,10,11,13).
What are the key properties of 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one?
2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 177.16 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-8H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 142266200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).