C17H17F3N2O3 — CID 142266275
3,4-difluoro-N-(2-hydroxyethoxy)benzamide;4-ethenyl-2-fluoroaniline (PubChem CID 142266275) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-hydroxyethoxy)benzamide;4-ethenyl-2-fluoroaniline.
| Compound Name | 3,4-difluoro-N-(2-hydroxyethoxy)benzamide;4-ethenyl-2-fluoroaniline |
|---|---|
| PubChem CID | 142266275 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3,4-difluoro-N-(2-hydroxyethoxy)benzamide;4-ethenyl-2-fluoroaniline |
| SMILES | C=Cc1ccc(N)c(F)c1.O=C(NOCCO)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9F2NO3.C8H8FN/c10-7-2-1-6(5-8(7)11)9(14)12-15-4-3-13;1-2-6-3-4-8(10)7(9)5-6/h1-2,5,13H,3-4H2,(H,12,14);2-5H,1,10H2 |
| InChIKey | WKXFWYGDANQEDP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|