C28H26N6O3 — CID 142266865
5-[(3aS,4R,7R,7aR)-4-methyl-7-[2-(5-methyl-1,7a-dihydrobenzotriazol-2-yl)ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 142266865) has the molecular formula C28H26N6O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is 5-[(3aS,4R,7R,7aR)-4-methyl-7-[2-(5-methyl-1,7a-dihydrobenzotriazol-2-yl)ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(3aS,4R,7R,7aR)-4-methyl-7-[2-(5-methyl-1,7a-dihydrobenzotriazol-2-yl)ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 142266865 |
| Molecular Formula | C28H26N6O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 5-[(3aS,4R,7R,7aR)-4-methyl-7-[2-(5-methyl-1,7a-dihydrobenzotriazol-2-yl)ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | CC1=CC2=NN(CC[C@@]34CC[C@@](C)(O3)[C@H]3C(=O)N(c5ccc(C#N)c6ncccc56)C(=O)[C@H]34)NC2C=C1 |
| InChI | InChI=1S/C28H26N6O3/c1-16-5-7-19-20(14-16)32-33(31-19)13-11-28-10-9-27(2,37-28)22-23(28)26(36)34(25(22)35)21-8-6-17(15-29)24-18(21)4-3-12-30-24/h3-8,12,14,19,22-23,31H,9-11,13H2,1-2H3/t19?,22-,23+,27-,28-/m1/s1 |
| InChIKey | WPTRARVIFZMHIU-PAZHSVLCSA-N |
| XLogP | 2.98 |
| TPSA | 110.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|