C20H35F2N2O4+ — CID 142267893
tert-butyl-[[[1-(4,4-difluorocyclohexyl)-2-[(3S)-2-methoxycarbonyl-3-methylpyrrolidin-1-yl]-2-oxoethyl]amino]methyl]oxidanium (PubChem CID 142267893) has the molecular formula C20H35F2N2O4+ and a molecular weight of 405.51 g/mol. Its IUPAC name is tert-butyl-[[[1-(4,4-difluorocyclohexyl)-2-[(3S)-2-methoxycarbonyl-3-methylpyrrolidin-1-yl]-2-oxoethyl]amino]methyl]oxidanium.
| Compound Name | tert-butyl-[[[1-(4,4-difluorocyclohexyl)-2-[(3S)-2-methoxycarbonyl-3-methylpyrrolidin-1-yl]-2-oxoethyl]amino]methyl]oxidanium |
|---|---|
| PubChem CID | 142267893 |
| Molecular Formula | C20H35F2N2O4+ |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | tert-butyl-[[[1-(4,4-difluorocyclohexyl)-2-[(3S)-2-methoxycarbonyl-3-methylpyrrolidin-1-yl]-2-oxoethyl]amino]methyl]oxidanium |
| SMILES | COC(=O)C1[C@@H](C)CCN1C(=O)C(NC[OH+]C(C)(C)C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C20H34F2N2O4/c1-13-8-11-24(16(13)18(26)27-5)17(25)15(23-12-28-19(2,3)4)14-6-9-20(21,22)10-7-14/h13-16,23H,6-12H2,1-5H3/p+1/t13-,15?,16?/m0/s1 |
| InChIKey | ZFPSUOGRUDIRRU-JEYLPNPQSA-O |
| XLogP | 2.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|