C15H19F2NO2 — CID 142268328
(3S,7aS)-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one;2,2-difluoropropane (PubChem CID 142268328) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is (3S,7aS)-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one;2,2-difluoropropane.
| Compound Name | (3S,7aS)-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one;2,2-difluoropropane |
|---|---|
| PubChem CID | 142268328 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3S,7aS)-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one;2,2-difluoropropane |
| SMILES | CC(C)(F)F.O=C1CC[C@H]2CO[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C12H13NO2.C3H6F2/c14-11-7-6-10-8-15-12(13(10)11)9-4-2-1-3-5-9;1-3(2,4)5/h1-5,10,12H,6-8H2;1-2H3/t10-,12-;/m0./s1 |
| InChIKey | QPPVUVPECUCWET-JGAZGGJJSA-N |
| XLogP | 3.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |