About [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate
[(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate (PubChem CID 142269804) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate.
Molecular Properties
| Compound Name | [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate |
| PubChem CID | 142269804 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate |
| SMILES | C=C/C=C\C(=C)COC(=O)NCCN |
| InChI | InChI=1S/C10H16N2O2/c1-3-4-5-9(2)8-14-10(13)12-7-6-11/h3-5H,1-2,6-8,11H2,(H,12,13)/b5-4- |
| InChIKey | KPMNFQHIGZPMRO-PLNGDYQASA-N |
| XLogP | 0.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate?
The IUPAC name of [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate (CID 142269804) is [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate.
What is the SMILES notation for [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate?
The canonical SMILES for [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate is C=C/C=C\C(=C)COC(=O)NCCN.
What is the InChIKey of [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate?
The InChIKey is KPMNFQHIGZPMRO-PLNGDYQASA-N. The full InChI is InChI=1S/C10H16N2O2/c1-3-4-5-9(2)8-14-10(13)12-7-6-11/h3-5H,1-2,6-8,11H2,(H,12,13)/b5-4-.
What are the key properties of [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate?
[(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate has a molecular weight of 196.25 g/mol, XLogP of 0.97, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-2-methylidenehexa-3,5-dienyl] N-(2-aminoethyl)carbamate is sourced from PubChem (CID 142269804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).