About 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane
1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane (PubChem CID 142270014) has the molecular formula C12H15F3
and a molecular weight of 216.25 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane.
Molecular Properties
| Compound Name | 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane |
| PubChem CID | 142270014 |
| Molecular Formula | C12H15F3 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane |
| SMILES | C=CC1=C(C=C)CC(C(F)(F)F)=C1.CC |
| InChI | InChI=1S/C10H9F3.C2H6/c1-3-7-5-9(10(11,12)13)6-8(7)4-2;1-2/h3-5H,1-2,6H2;1-2H3 |
| InChIKey | WKXDFTNQYKKTMJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane?
The IUPAC name of 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane (CID 142270014) is 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane.
What is the SMILES notation for 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane?
The canonical SMILES for 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane is C=CC1=C(C=C)CC(C(F)(F)F)=C1.CC.
What is the InChIKey of 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane?
The InChIKey is WKXDFTNQYKKTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3.C2H6/c1-3-7-5-9(10(11,12)13)6-8(7)4-2;1-2/h3-5H,1-2,6H2;1-2H3.
What are the key properties of 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane?
1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane has a molecular weight of 216.25 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(ethenyl)-4-(trifluoromethyl)cyclopenta-1,3-diene;ethane is sourced from PubChem (CID 142270014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).