C10H15NO2 — CID 142270040
(3aS)-2-(nitromethylidene)-1,3,3a,4,5,6,7,7a-octahydroindene (PubChem CID 142270040) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (3aS)-2-(nitromethylidene)-1,3,3a,4,5,6,7,7a-octahydroindene.
| Compound Name | (3aS)-2-(nitromethylidene)-1,3,3a,4,5,6,7,7a-octahydroindene |
|---|---|
| PubChem CID | 142270040 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3aS)-2-(nitromethylidene)-1,3,3a,4,5,6,7,7a-octahydroindene |
| SMILES | O=[N+]([O-])/C=C1/CC2CCCC[C@H]2C1 |
| InChI | InChI=1S/C10H15NO2/c12-11(13)7-8-5-9-3-1-2-4-10(9)6-8/h7,9-10H,1-6H2/b8-7-/t9?,10-/m0/s1 |
| InChIKey | RINUOGKBBZSXQI-HRYVJHRQSA-N |
| XLogP | 2.75 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|