About ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one
ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one (PubChem CID 142270235) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one.
Molecular Properties
| Compound Name | ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one |
| PubChem CID | 142270235 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one |
| SMILES | CC.CC/C=C(\C)CC/C=C(\C)C1=CC(=O)C(C)O1 |
| InChI | InChI=1S/C15H22O2.C2H6/c1-5-7-11(2)8-6-9-12(3)15-10-14(16)13(4)17-15;1-2/h7,9-10,13H,5-6,8H2,1-4H3;1-2H3/b11-7+,12-9+; |
| InChIKey | NTQLQRCFFGZOCQ-TZSSSIPKSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one?
The IUPAC name of ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one (CID 142270235) is ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one.
What is the SMILES notation for ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one?
The canonical SMILES for ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one is CC.CC/C=C(\C)CC/C=C(\C)C1=CC(=O)C(C)O1.
What is the InChIKey of ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one?
The InChIKey is NTQLQRCFFGZOCQ-TZSSSIPKSA-N. The full InChI is InChI=1S/C15H22O2.C2H6/c1-5-7-11(2)8-6-9-12(3)15-10-14(16)13(4)17-15;1-2/h7,9-10,13H,5-6,8H2,1-4H3;1-2H3/b11-7+,12-9+;.
What are the key properties of ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one?
ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one has a molecular weight of 264.41 g/mol, XLogP of 4.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]furan-3-one is sourced from PubChem (CID 142270235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).