About 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline
2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline (PubChem CID 142270450) has the molecular formula C19H24Cl3N3O
and a molecular weight of 416.78 g/mol. Its IUPAC name is 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline.
Molecular Properties
| Compound Name | 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline |
| PubChem CID | 142270450 |
| Molecular Formula | C19H24Cl3N3O |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline |
| SMILES | CNc1c(C)cccc1Cl.NCCN(CC=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O.C8H10ClN/c12-10-2-1-3-11(13)9(10)8-15(5-4-14)6-7-16;1-6-4-3-5-7(9)8(6)10-2/h1-3,7H,4-6,8,14H2;3-5,10H,1-2H3 |
| InChIKey | KDMHWPUYNHJPMS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline?
The IUPAC name of 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline (CID 142270450) is 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline.
What is the SMILES notation for 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline?
The canonical SMILES for 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline is CNc1c(C)cccc1Cl.NCCN(CC=O)Cc1c(Cl)cccc1Cl.
What is the InChIKey of 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline?
The InChIKey is KDMHWPUYNHJPMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N2O.C8H10ClN/c12-10-2-1-3-11(13)9(10)8-15(5-4-14)6-7-16;1-6-4-3-5-7(9)8(6)10-2/h1-3,7H,4-6,8,14H2;3-5,10H,1-2H3.
What are the key properties of 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline?
2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline has a molecular weight of 416.78 g/mol, XLogP of 4.64, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl-[(2,6-dichlorophenyl)methyl]amino]acetaldehyde;2-chloro-N,6-dimethylaniline is sourced from PubChem (CID 142270450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).