About [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate
[1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate (PubChem CID 142270587) has the molecular formula C20H21FN4O3
and a molecular weight of 384.41 g/mol. Its IUPAC name is [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate.
Molecular Properties
| Compound Name | [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate |
| PubChem CID | 142270587 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate |
| SMILES | CCC(=O)NCC(CNc1ccc(-n2cc3cccnc3c2)c(F)c1)OC=O |
| InChI | InChI=1S/C20H21FN4O3/c1-2-20(27)24-10-16(28-13-26)9-23-15-5-6-19(17(21)8-15)25-11-14-4-3-7-22-18(14)12-25/h3-8,11-13,16,23H,2,9-10H2,1H3,(H,24,27) |
| InChIKey | CLOCQNBKFAGLFL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate?
The IUPAC name of [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate (CID 142270587) is [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate.
What is the SMILES notation for [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate?
The canonical SMILES for [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate is CCC(=O)NCC(CNc1ccc(-n2cc3cccnc3c2)c(F)c1)OC=O.
What is the InChIKey of [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate?
The InChIKey is CLOCQNBKFAGLFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN4O3/c1-2-20(27)24-10-16(28-13-26)9-23-15-5-6-19(17(21)8-15)25-11-14-4-3-7-22-18(14)12-25/h3-8,11-13,16,23H,2,9-10H2,1H3,(H,24,27).
What are the key properties of [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate?
[1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate has a molecular weight of 384.41 g/mol, XLogP of 2.64, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-fluoro-4-pyrrolo[3,4-b]pyridin-6-ylanilino)-3-(propanoylamino)propan-2-yl] formate is sourced from PubChem (CID 142270587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).