C12H18F2NO2+ — CID 142270711
[3-(2,6-difluoro-3-methylphenyl)-4-hydroxy-4-methoxybutyl]azanium (PubChem CID 142270711) has the molecular formula C12H18F2NO2+ and a molecular weight of 246.28 g/mol. Its IUPAC name is [3-(2,6-difluoro-3-methylphenyl)-4-hydroxy-4-methoxybutyl]azanium.
| Compound Name | [3-(2,6-difluoro-3-methylphenyl)-4-hydroxy-4-methoxybutyl]azanium |
|---|---|
| PubChem CID | 142270711 |
| Molecular Formula | C12H18F2NO2+ |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [3-(2,6-difluoro-3-methylphenyl)-4-hydroxy-4-methoxybutyl]azanium |
| SMILES | COC(O)C(CC[NH3+])c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C12H17F2NO2/c1-7-3-4-9(13)10(11(7)14)8(5-6-15)12(16)17-2/h3-4,8,12,16H,5-6,15H2,1-2H3/p+1 |
| InChIKey | UOZAMSZQRNKAQL-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 57.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|