About 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol
1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol (PubChem CID 14227093) has the molecular formula C18H42O2Si2
and a molecular weight of 346.70 g/mol. Its IUPAC name is 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol.
Molecular Properties
| Compound Name | 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol |
| PubChem CID | 14227093 |
| Molecular Formula | C18H42O2Si2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol |
| SMILES | CCCCCCCCC(O)CC(OC)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H42O2Si2/c1-9-10-11-12-13-14-15-17(19)16-18(20-2,21(3,4)5)22(6,7)8/h17,19H,9-16H2,1-8H3 |
| InChIKey | HJDKDOKQXINYKW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol?
The IUPAC name of 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol (CID 14227093) is 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol.
What is the SMILES notation for 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol?
The canonical SMILES for 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol is CCCCCCCCC(O)CC(OC)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol?
The InChIKey is HJDKDOKQXINYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H42O2Si2/c1-9-10-11-12-13-14-15-17(19)16-18(20-2,21(3,4)5)22(6,7)8/h17,19H,9-16H2,1-8H3.
What are the key properties of 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol?
1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol has a molecular weight of 346.70 g/mol, XLogP of 5.63, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1,1-bis(trimethylsilyl)undecan-3-ol is sourced from PubChem (CID 14227093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).