C18H15F3N2OS2 — CID 142271228
2,2,2-trifluoro-1-[4-[methyl(phenylsulfanyl)amino]phenyl]-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 142271228) has the molecular formula C18H15F3N2OS2 and a molecular weight of 396.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[methyl(phenylsulfanyl)amino]phenyl]-1-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-[4-[methyl(phenylsulfanyl)amino]phenyl]-1-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 142271228 |
| Molecular Formula | C18H15F3N2OS2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[methyl(phenylsulfanyl)amino]phenyl]-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | CN(Sc1ccccc1)c1ccc(C(O)(c2nccs2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N2OS2/c1-23(26-15-5-3-2-4-6-15)14-9-7-13(8-10-14)17(24,18(19,20)21)16-22-11-12-25-16/h2-12,24H,1H3 |
| InChIKey | BAJSMYUYPJQYBN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|