About 1,6-dihydropyrazolo[5,4-b]azepine;ethane
1,6-dihydropyrazolo[5,4-b]azepine;ethane (PubChem CID 142271294) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,6-dihydropyrazolo[5,4-b]azepine;ethane.
Molecular Properties
| Compound Name | 1,6-dihydropyrazolo[5,4-b]azepine;ethane |
| PubChem CID | 142271294 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1,6-dihydropyrazolo[5,4-b]azepine;ethane |
| SMILES | C1=Cc2cn[nH]c2N=CC1.CC |
| InChI | InChI=1S/C7H7N3.C2H6/c1-2-4-8-7-6(3-1)5-9-10-7;1-2/h1,3-5H,2H2,(H,9,10);1-2H3 |
| InChIKey | HPJUQOXRDDILNJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-dihydropyrazolo[5,4-b]azepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrazolo[5,4-b]azepine;ethane?
The IUPAC name of 1,6-dihydropyrazolo[5,4-b]azepine;ethane (CID 142271294) is 1,6-dihydropyrazolo[5,4-b]azepine;ethane.
What is the SMILES notation for 1,6-dihydropyrazolo[5,4-b]azepine;ethane?
The canonical SMILES for 1,6-dihydropyrazolo[5,4-b]azepine;ethane is C1=Cc2cn[nH]c2N=CC1.CC.
What is the InChIKey of 1,6-dihydropyrazolo[5,4-b]azepine;ethane?
The InChIKey is HPJUQOXRDDILNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C2H6/c1-2-4-8-7-6(3-1)5-9-10-7;1-2/h1,3-5H,2H2,(H,9,10);1-2H3.
What are the key properties of 1,6-dihydropyrazolo[5,4-b]azepine;ethane?
1,6-dihydropyrazolo[5,4-b]azepine;ethane has a molecular weight of 163.22 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrazolo[5,4-b]azepine;ethane is sourced from PubChem (CID 142271294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).