C22H27NO2S — CID 142271520
(E,2E)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-(1-hydroxyethylidene)pent-3-enamide (PubChem CID 142271520) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is (E,2E)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-(1-hydroxyethylidene)pent-3-enamide.
| Compound Name | (E,2E)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-(1-hydroxyethylidene)pent-3-enamide |
|---|---|
| PubChem CID | 142271520 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (E,2E)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-(1-hydroxyethylidene)pent-3-enamide |
| SMILES | C/C=C/C(C(=O)NCC1(c2csc3ccccc23)CCCCC1)=C(/C)O |
| InChI | InChI=1S/C22H27NO2S/c1-3-9-17(16(2)24)21(25)23-15-22(12-7-4-8-13-22)19-14-26-20-11-6-5-10-18(19)20/h3,5-6,9-11,14,24H,4,7-8,12-13,15H2,1-2H3,(H,23,25)/b9-3+,17-16+ |
| InChIKey | FOBOPABWMITTIW-NFKCZWBASA-N |
| XLogP | 5.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|