About ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine
ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine (PubChem CID 142271601) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine.
Molecular Properties
| Compound Name | ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine |
| PubChem CID | 142271601 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine |
| SMILES | C=C/C=C1/NNC/C1=C/C.CC |
| InChI | InChI=1S/C8H12N2.C2H6/c1-3-5-8-7(4-2)6-9-10-8;1-2/h3-5,9-10H,1,6H2,2H3;1-2H3/b7-4-,8-5+; |
| InChIKey | XLSTXGGHTRANDA-QMKOBIDDSA-N |
| XLogP | 2.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine?
The IUPAC name of ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine (CID 142271601) is ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine.
What is the SMILES notation for ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine?
The canonical SMILES for ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine is C=C/C=C1/NNC/C1=C/C.CC.
What is the InChIKey of ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine?
The InChIKey is XLSTXGGHTRANDA-QMKOBIDDSA-N. The full InChI is InChI=1S/C8H12N2.C2H6/c1-3-5-8-7(4-2)6-9-10-8;1-2/h3-5,9-10H,1,6H2,2H3;1-2H3/b7-4-,8-5+;.
What are the key properties of ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine?
ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine has a molecular weight of 166.27 g/mol, XLogP of 2.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyrazolidine is sourced from PubChem (CID 142271601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).