C28H32F2O6S — CID 142271982
(6S,9R,16R,17S)-6,9-difluoro-17-[2-(furan-2-carbonyloxy)ethyl]-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 142271982) has the molecular formula C28H32F2O6S and a molecular weight of 534.62 g/mol. Its IUPAC name is (6S,9R,16R,17S)-6,9-difluoro-17-[2-(furan-2-carbonyloxy)ethyl]-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (6S,9R,16R,17S)-6,9-difluoro-17-[2-(furan-2-carbonyloxy)ethyl]-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 142271982 |
| Molecular Formula | C28H32F2O6S |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (6S,9R,16R,17S)-6,9-difluoro-17-[2-(furan-2-carbonyloxy)ethyl]-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1CC2C3C[C@H](F)C4=CC(=O)C=CC4(C)[C@@]3(F)C(O)CC2(C)[C@@]1(CCOC(=O)c1ccco1)C(=O)S |
| InChI | InChI=1S/C28H32F2O6S/c1-15-11-17-18-13-20(29)19-12-16(31)6-7-25(19,2)28(18,30)22(32)14-26(17,3)27(15,24(34)37)8-10-36-23(33)21-5-4-9-35-21/h4-7,9,12,15,17-18,20,22,32H,8,10-11,13-14H2,1-3H3,(H,34,37)/t15-,17?,18?,20+,22?,25?,26?,27-,28+/m1/s1 |
| InChIKey | ISIQCSZIWDGMBC-BRFQFJQBSA-N |
| XLogP | 4.83 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|