C15H19NO — CID 142272143
(2Z,4E)-N,4-dimethyl-5-(2-methylcyclohepta-1,3,6-trien-1-yl)oxypenta-2,4-dien-1-imine (PubChem CID 142272143) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (2Z,4E)-N,4-dimethyl-5-(2-methylcyclohepta-1,3,6-trien-1-yl)oxypenta-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-N,4-dimethyl-5-(2-methylcyclohepta-1,3,6-trien-1-yl)oxypenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142272143 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2Z,4E)-N,4-dimethyl-5-(2-methylcyclohepta-1,3,6-trien-1-yl)oxypenta-2,4-dien-1-imine |
| SMILES | C/N=C/C=C\C(C)=C\OC1=C(C)C=CCC=C1 |
| InChI | InChI=1S/C15H19NO/c1-13(8-7-11-16-3)12-17-15-10-6-4-5-9-14(15)2/h5-12H,4H2,1-3H3/b8-7-,13-12+,16-11+ |
| InChIKey | JAWKXJVCGGWGFQ-NNUCWZQKSA-N |
| XLogP | 3.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|