C14H27FN2 — CID 142272190
ethane;N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine (PubChem CID 142272190) has the molecular formula C14H27FN2 and a molecular weight of 242.38 g/mol. Its IUPAC name is ethane;N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine.
| Compound Name | ethane;N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142272190 |
| Molecular Formula | C14H27FN2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | ethane;N'-ethyl-N'-[(2Z,4Z)-2-fluorohepta-2,4,6-trien-3-yl]-N-methylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C(/C)F)N(CC)CCNC.CC |
| InChI | InChI=1S/C12H21FN2.C2H6/c1-5-7-8-12(11(3)13)15(6-2)10-9-14-4;1-2/h5,7-8,14H,1,6,9-10H2,2-4H3;1-2H3/b8-7-,12-11-; |
| InChIKey | NWKOBUZHKRTJKZ-LDJJJCFBSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|