About 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine
4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine (PubChem CID 142272948) has the molecular formula C14H20ClN3
and a molecular weight of 265.79 g/mol. Its IUPAC name is 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine |
| PubChem CID | 142272948 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine |
| SMILES | C/C=c1/nc(C2CCNCC2)[nH]/c1=C/C(C)=C/Cl |
| InChI | InChI=1S/C14H20ClN3/c1-3-12-13(8-10(2)9-15)18-14(17-12)11-4-6-16-7-5-11/h3,8-9,11,16H,4-7H2,1-2H3,(H,17,18)/b10-9+,12-3+,13-8+ |
| InChIKey | QKHCKNCLYOGLQP-IWCBRQFUSA-N |
| XLogP | 1.60 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine?
The IUPAC name of 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine (CID 142272948) is 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine.
What is the SMILES notation for 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine?
The canonical SMILES for 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine is C/C=c1/nc(C2CCNCC2)[nH]/c1=C/C(C)=C/Cl.
What is the InChIKey of 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine?
The InChIKey is QKHCKNCLYOGLQP-IWCBRQFUSA-N. The full InChI is InChI=1S/C14H20ClN3/c1-3-12-13(8-10(2)9-15)18-14(17-12)11-4-6-16-7-5-11/h3,8-9,11,16H,4-7H2,1-2H3,(H,17,18)/b10-9+,12-3+,13-8+.
What are the key properties of 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine?
4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine has a molecular weight of 265.79 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4E,5E)-5-[(E)-3-chloro-2-methylprop-2-enylidene]-4-ethylidene-1H-imidazol-2-yl]piperidine is sourced from PubChem (CID 142272948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).