C14H14ClN3 — CID 142272978
2-(1H-benzimidazol-2-yl)-4-chloro-4-methylcyclohexa-1,5-dien-1-amine (PubChem CID 142272978) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-chloro-4-methylcyclohexa-1,5-dien-1-amine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-chloro-4-methylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 142272978 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-chloro-4-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1(Cl)C=CC(N)=C(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C14H14ClN3/c1-14(15)7-6-10(16)9(8-14)13-17-11-4-2-3-5-12(11)18-13/h2-7H,8,16H2,1H3,(H,17,18) |
| InChIKey | HCQBSAFYYUHNOU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|