About 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde
5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde (PubChem CID 142273224) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde |
| PubChem CID | 142273224 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde |
| SMILES | COc1c(C=O)cc(CC(C)(C)C)cc1C=O |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)7-10-5-11(8-15)13(17-4)12(6-10)9-16/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | AKTQGNDREJFAQV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde?
The IUPAC name of 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde (CID 142273224) is 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde.
What is the SMILES notation for 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde?
The canonical SMILES for 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde is COc1c(C=O)cc(CC(C)(C)C)cc1C=O.
What is the InChIKey of 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde?
The InChIKey is AKTQGNDREJFAQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-14(2,3)7-10-5-11(8-15)13(17-4)12(6-10)9-16/h5-6,8-9H,7H2,1-4H3.
What are the key properties of 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde?
5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde has a molecular weight of 234.29 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpropyl)-2-methoxybenzene-1,3-dicarbaldehyde is sourced from PubChem (CID 142273224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).