C22H23ClFNO4 — CID 142273599
butyl 5-(4-chlorophenyl)-3-[(2-fluorophenyl)-hydroxymethyl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 142273599) has the molecular formula C22H23ClFNO4 and a molecular weight of 419.88 g/mol. Its IUPAC name is butyl 5-(4-chlorophenyl)-3-[(2-fluorophenyl)-hydroxymethyl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | butyl 5-(4-chlorophenyl)-3-[(2-fluorophenyl)-hydroxymethyl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142273599 |
| Molecular Formula | C22H23ClFNO4 |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | butyl 5-(4-chlorophenyl)-3-[(2-fluorophenyl)-hydroxymethyl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C(=O)C(C(O)c2ccccc2F)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClFNO4/c1-2-3-12-29-22(28)25-19(14-8-10-15(23)11-9-14)13-17(21(25)27)20(26)16-6-4-5-7-18(16)24/h4-11,17,19-20,26H,2-3,12-13H2,1H3 |
| InChIKey | CRKKICITAXAXRY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|