C32H45N5O6 — CID 142273896
N-[4,6-dimethoxy-2-(3-morpholin-4-ylpropylamino)-1,2-dihydropyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide (PubChem CID 142273896) has the molecular formula C32H45N5O6 and a molecular weight of 595.74 g/mol. Its IUPAC name is N-[4,6-dimethoxy-2-(3-morpholin-4-ylpropylamino)-1,2-dihydropyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[4,6-dimethoxy-2-(3-morpholin-4-ylpropylamino)-1,2-dihydropyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 142273896 |
| Molecular Formula | C32H45N5O6 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | N-[4,6-dimethoxy-2-(3-morpholin-4-ylpropylamino)-1,2-dihydropyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
| SMILES | COC1=NC(NCCCN2CCOCC2)NC(OC)=C1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)OC3(C)C)o1 |
| InChI | InChI=1S/C32H45N5O6/c1-20-17-23-24(32(4,5)43-31(23,2)3)19-21(20)18-22-9-10-25(42-22)27(38)34-26-28(39-6)35-30(36-29(26)40-7)33-11-8-12-37-13-15-41-16-14-37/h9-10,17,19,30,33,35H,8,11-16,18H2,1-7H3,(H,34,38) |
| InChIKey | KMFWEKSCUWPSFU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|