About propan-1-amine;6-propoxyhept-1-ene
propan-1-amine;6-propoxyhept-1-ene (PubChem CID 142274403) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is propan-1-amine;6-propoxyhept-1-ene.
Molecular Properties
| Compound Name | propan-1-amine;6-propoxyhept-1-ene |
| PubChem CID | 142274403 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | propan-1-amine;6-propoxyhept-1-ene |
| SMILES | C=CCCCC(C)OCCC.CCCN |
| InChI | InChI=1S/C10H20O.C3H9N/c1-4-6-7-8-10(3)11-9-5-2;1-2-3-4/h4,10H,1,5-9H2,2-3H3;2-4H2,1H3 |
| InChIKey | BQLBHTINEONHGW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propan-1-amine;6-propoxyhept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-1-amine;6-propoxyhept-1-ene?
The IUPAC name of propan-1-amine;6-propoxyhept-1-ene (CID 142274403) is propan-1-amine;6-propoxyhept-1-ene.
What is the SMILES notation for propan-1-amine;6-propoxyhept-1-ene?
The canonical SMILES for propan-1-amine;6-propoxyhept-1-ene is C=CCCCC(C)OCCC.CCCN.
What is the InChIKey of propan-1-amine;6-propoxyhept-1-ene?
The InChIKey is BQLBHTINEONHGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C3H9N/c1-4-6-7-8-10(3)11-9-5-2;1-2-3-4/h4,10H,1,5-9H2,2-3H3;2-4H2,1H3.
What are the key properties of propan-1-amine;6-propoxyhept-1-ene?
propan-1-amine;6-propoxyhept-1-ene has a molecular weight of 215.38 g/mol, XLogP of 3.51, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-1-amine;6-propoxyhept-1-ene is sourced from PubChem (CID 142274403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).