C16H25ClN2O2S — CID 142274534
1-[4-(3-chloro-4-methyl-2-sulfanylphenoxy)piperidin-1-yl]-3-(methylamino)propan-2-ol (PubChem CID 142274534) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-methyl-2-sulfanylphenoxy)piperidin-1-yl]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[4-(3-chloro-4-methyl-2-sulfanylphenoxy)piperidin-1-yl]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 142274534 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[4-(3-chloro-4-methyl-2-sulfanylphenoxy)piperidin-1-yl]-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)CN1CCC(Oc2ccc(C)c(Cl)c2S)CC1 |
| InChI | InChI=1S/C16H25ClN2O2S/c1-11-3-4-14(16(22)15(11)17)21-13-5-7-19(8-6-13)10-12(20)9-18-2/h3-4,12-13,18,20,22H,5-10H2,1-2H3 |
| InChIKey | NWAXPOHBMVZDNZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|