About 2-decyl-2H-furan-5-one
2-decyl-2H-furan-5-one (PubChem CID 14227493) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-decyl-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-decyl-2H-furan-5-one |
| PubChem CID | 14227493 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-decyl-2H-furan-5-one |
| SMILES | CCCCCCCCCCC1C=CC(=O)O1 |
| InChI | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-13-11-12-14(15)16-13/h11-13H,2-10H2,1H3 |
| InChIKey | SKFLHLHXKUSHDF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decyl-2H-furan-5-one?
The IUPAC name of 2-decyl-2H-furan-5-one (CID 14227493) is 2-decyl-2H-furan-5-one.
What is the SMILES notation for 2-decyl-2H-furan-5-one?
The canonical SMILES for 2-decyl-2H-furan-5-one is CCCCCCCCCCC1C=CC(=O)O1.
What is the InChIKey of 2-decyl-2H-furan-5-one?
The InChIKey is SKFLHLHXKUSHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-13-11-12-14(15)16-13/h11-13H,2-10H2,1H3.
What are the key properties of 2-decyl-2H-furan-5-one?
2-decyl-2H-furan-5-one has a molecular weight of 224.34 g/mol, XLogP of 4.00, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decyl-2H-furan-5-one is sourced from PubChem (CID 14227493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).