C14H31N3 — CID 142275000
ethane;(3E,5Z)-3-methylhepta-3,5-dien-1-imine;N'-methylpropane-1,3-diamine (PubChem CID 142275000) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;(3E,5Z)-3-methylhepta-3,5-dien-1-imine;N'-methylpropane-1,3-diamine.
| Compound Name | ethane;(3E,5Z)-3-methylhepta-3,5-dien-1-imine;N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 142275000 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | ethane;(3E,5Z)-3-methylhepta-3,5-dien-1-imine;N'-methylpropane-1,3-diamine |
| SMILES | CC.CNCCCN.[H]/N=C/C/C(C)=C/C=C\C |
| InChI | InChI=1S/C8H13N.C4H12N2.C2H6/c1-3-4-5-8(2)6-7-9;1-6-4-2-3-5;1-2/h3-5,7,9H,6H2,1-2H3;6H,2-5H2,1H3;1-2H3/b4-3-,8-5+,9-7+;; |
| InChIKey | UDSRMPUWTPZRJJ-QZQGEVBUSA-N |
| XLogP | 3.13 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|