C16H28FNO — CID 142275035
but-3-en-2-ol;ethane;N-[(3-fluorophenyl)methyl]propan-1-amine (PubChem CID 142275035) has the molecular formula C16H28FNO and a molecular weight of 269.40 g/mol. Its IUPAC name is but-3-en-2-ol;ethane;N-[(3-fluorophenyl)methyl]propan-1-amine.
| Compound Name | but-3-en-2-ol;ethane;N-[(3-fluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 142275035 |
| Molecular Formula | C16H28FNO |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | but-3-en-2-ol;ethane;N-[(3-fluorophenyl)methyl]propan-1-amine |
| SMILES | C=CC(C)O.CC.CCCNCc1cccc(F)c1 |
| InChI | InChI=1S/C10H14FN.C4H8O.C2H6/c1-2-6-12-8-9-4-3-5-10(11)7-9;1-3-4(2)5;1-2/h3-5,7,12H,2,6,8H2,1H3;3-5H,1H2,2H3;1-2H3 |
| InChIKey | IAQRFCVLJXOOOE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|