C17H17F2NO2 — CID 142275063
1-but-3-enyl-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one (PubChem CID 142275063) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is 1-but-3-enyl-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one.
| Compound Name | 1-but-3-enyl-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 142275063 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-but-3-enyl-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one |
| SMILES | C=CCCn1c(C)cc(OCc2ccc(F)cc2F)cc1=O |
| InChI | InChI=1S/C17H17F2NO2/c1-3-4-7-20-12(2)8-15(10-17(20)21)22-11-13-5-6-14(18)9-16(13)19/h3,5-6,8-10H,1,4,7,11H2,2H3 |
| InChIKey | DUAWIKPDMNMGLH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|