C9H12F3NS — CID 142275285
(2E,4E)-N-methyl-5-(trifluoromethylsulfanyl)hepta-2,4,6-trien-2-amine (PubChem CID 142275285) has the molecular formula C9H12F3NS and a molecular weight of 223.26 g/mol. Its IUPAC name is (2E,4E)-N-methyl-5-(trifluoromethylsulfanyl)hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-N-methyl-5-(trifluoromethylsulfanyl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 142275285 |
| Molecular Formula | C9H12F3NS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | (2E,4E)-N-methyl-5-(trifluoromethylsulfanyl)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)NC)SC(F)(F)F |
| InChI | InChI=1S/C9H12F3NS/c1-4-8(14-9(10,11)12)6-5-7(2)13-3/h4-6,13H,1H2,2-3H3/b7-5+,8-6+ |
| InChIKey | COUDHKFPMXUZPQ-KQQUZDAGSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|