C25H27ClN8O — CID 142275286
5-(4-chlorophenyl)-N-(4-methylphenyl)-4-[4-(4-methyl-2,3,5,6-tetrahydro-1,2,4-triazepin-3-yl)pyrazol-1-yl]-3,4-dihydropyrazole-2-carboxamide (PubChem CID 142275286) has the molecular formula C25H27ClN8O and a molecular weight of 491.00 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(4-methylphenyl)-4-[4-(4-methyl-2,3,5,6-tetrahydro-1,2,4-triazepin-3-yl)pyrazol-1-yl]-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(4-methylphenyl)-4-[4-(4-methyl-2,3,5,6-tetrahydro-1,2,4-triazepin-3-yl)pyrazol-1-yl]-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 142275286 |
| Molecular Formula | C25H27ClN8O |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(4-methylphenyl)-4-[4-(4-methyl-2,3,5,6-tetrahydro-1,2,4-triazepin-3-yl)pyrazol-1-yl]-3,4-dihydropyrazole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CC(n3cc(C4NN=CCCN4C)cn3)C(c3ccc(Cl)cc3)=N2)cc1 |
| InChI | InChI=1S/C25H27ClN8O/c1-17-4-10-21(11-5-17)29-25(35)34-16-22(23(31-34)18-6-8-20(26)9-7-18)33-15-19(14-28-33)24-30-27-12-3-13-32(24)2/h4-12,14-15,22,24,30H,3,13,16H2,1-2H3,(H,29,35) |
| InChIKey | DQVCJIRUUUPYLX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |