C11H11F2N — CID 142275946
(6E)-3,5-difluoro-N-methyl-6-(2-methylprop-2-enylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 142275946) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is (6E)-3,5-difluoro-N-methyl-6-(2-methylprop-2-enylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-3,5-difluoro-N-methyl-6-(2-methylprop-2-enylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142275946 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (6E)-3,5-difluoro-N-methyl-6-(2-methylprop-2-enylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | C=C(C)/C=C1/C(F)=CC(F)=C/C1=N\C |
| InChI | InChI=1S/C11H11F2N/c1-7(2)4-9-10(13)5-8(12)6-11(9)14-3/h4-6H,1H2,2-3H3/b9-4-,14-11+ |
| InChIKey | SVMLGVPRUFQUIU-AAWJIYQBSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|